* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0541 |
| EnglishSynonyms: | RARECHEM AL BZ 0541 |
| pro_mdlNumber: | MFCD06216635 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | CC(CCCC(C)(C)O)CC(CC(=O)N)N |
| InChi: | InChI=1S/C12H26N2O2/c1-9(5-4-6-12(2,3)16)7-10(13)8-11(14)15/h9-10,16H,4-8,13H2,1-3H3,(H2,14,15) |
| InChiKey: | InChIKey=SOZHTDFKQGWPLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.