* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 9089 |
| EnglishSynonyms: | RARECHEM AQ BC 9089 |
| pro_mdlNumber: | MFCD06227597 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | C[C@H](c1ccccc1)NC(=O)O[C@H]2C[C@H]([C@@H]3C[C@@H]2[C@@H](CC3=O)c4ccccc4)c5ccccc5 |
| InChi: | InChI=1S/C30H31NO3/c1-20(21-11-5-2-6-12-21)31-30(33)34-29-19-25(23-15-9-4-10-16-23)26-17-27(29)24(18-28(26)32)22-13-7-3-8-14-22/h2-16,20,24-27,29H,17-19H2,1H3,(H,31,33)/t20-,24+,25+,26?,27?,29+/m1/s1 |
| InChiKey: | InChIKey=WNFNJYFDGYDPKR-GGMCYPIOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.