* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 0611 |
| EnglishSynonyms: | RARECHEM AN KC 0611 |
| pro_mdlNumber: | MFCD08453033 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(Cc1c(nn(c1Oc2cccc(c2)C(F)(F)F)C)C(F)(F)F)N |
| InChi: | InChI=1S/C15H15F6N3O/c1-8(22)6-11-12(15(19,20)21)23-24(2)13(11)25-10-5-3-4-9(7-10)14(16,17)18/h3-5,7-8H,6,22H2,1-2H3 |
| InChiKey: | InChIKey=KBNWCIILNHRNLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.