* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0660 |
| EnglishSynonyms: | RARECHEM AN KD 0660 |
| pro_mdlNumber: | MFCD08455121 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1cc(c(cc1C(F)(F)F)CC(CO)N)C(F)(F)F.Cl |
| InChi: | InChI=1S/C11H11F6NO.ClH/c12-10(13,14)7-1-2-9(11(15,16)17)6(3-7)4-8(18)5-19;/h1-3,8,19H,4-5,18H2;1H |
| InChiKey: | InChIKey=BAZDGMAWPSUIBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.