* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110207-001 |
EnglishSynonyms: | WUXIAPPTEC WX110207-001 ; WUXIAPPTEC WX110207-010 ; WUXIAPPTEC WX110207-005 |
pro_mdlNumber: | MFCD17016460 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1CCCC2C(N)CCC12 |
InChi: | InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-8-4-5-9-10(14)6-7-11(9)15/h9-11H,4-8,14H2,1-3H3 |
InChiKey: | InChIKey=RJIUIJWKWRYISX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.