* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX110295-001 |
EnglishSynonyms: | WUXIAPPTEC WX110295-005 ; WUXIAPPTEC WX110295-001 ; WUXIAPPTEC WX110295-010 |
pro_mdlNumber: | MFCD17016543 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1C[C@@H]2NCCCO[C@@H]2C1 |
InChi: | InChI=1S/C12H22N2O3/c1-12(2,3)17-11(15)14-7-9-10(8-14)16-6-4-5-13-9/h9-10,13H,4-8H2,1-3H3/t9-,10+/m0/s1 |
InChiKey: | InChIKey=RBGFNUUXDNXFDE-VHSXEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.