* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | WUXIAPPTEC WX115227-001 |
EnglishSynonyms: | WUXIAPPTEC WX115227-010 ; WUXIAPPTEC WX115227-001 ; WUXIAPPTEC WX115227-005 |
pro_mdlNumber: | MFCD17017552 |
pro_acceptors: | 7 |
pro_donors: | 1 |
pro_smile: | CC(C)(C)OC(=O)N1C[C@H]2NC[C@@H]3CN(C[C@]23C1)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C21H29N3O4/c1-20(2,3)28-19(26)24-11-17-21(14-24)13-23(10-16(21)9-22-17)18(25)27-12-15-7-5-4-6-8-15/h4-8,16-17,22H,9-14H2,1-3H3/t16-,17-,21-/m1/s1 |
InChiKey: | InChIKey=RVZABLJMVCCKNV-CBGDNZLLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.