* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PYROCATECHOL, 4,5-DIAMINO-, DI-HCL |
| CAS: | 861584-13-6 |
| EnglishSynonyms: | PYROCATECHOL, 4,5-DIAMINO-, DI-HCL |
| pro_mdlNumber: | MFCD17018271 |
| pro_acceptors: | 4 |
| pro_donors: | 4 |
| pro_smile: | c1c(c(cc(c1O)O)N)N.Cl.Cl |
| InChi: | InChI=1S/C6H8N2O2.2ClH/c7-3-1-5(9)6(10)2-4(3)8;;/h1-2,9-10H,7-8H2;2*1H |
| InChiKey: | InChIKey=BMBVYHMBHPYJTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.