* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9-AZABICYCLO[6.1.0]NONA-2,4,6-TRIENE, 9-ACETYL-, CIS- |
| CAS: | 41079-30-5 |
| EnglishSynonyms: | CIS-9-ACETYL-9-AZABICYCLO[6.1.0]NONA-2,4,6-TRIENE ; 9-AZABICYCLO[6.1.0]NONA-2,4,6-TRIENE, 9-ACETYL-, CIS- |
| pro_mdlNumber: | MFCD18829619 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CC(=O)N1[C@@H]/2[C@H]1/C=C\C=C/C=C2 |
| InChi: | InChI=1S/C10H11NO/c1-8(12)11-9-6-4-2-3-5-7-10(9)11/h2-7,9-10H,1H3/b3-2-,6-4-,7-5-/t9-,10+,11? |
| InChiKey: | InChIKey=KPOZJESHQRPVOF-XCAMVOFDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.