* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | Q 29 2-HYDROXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| CAS: | 62830-53-9 |
| EnglishSynonyms: | Q 29 2-HYDROXY-3-ISOBUTYL-1,4-NAPHTHOQUINONE |
| pro_mdlNumber: | MFCD00019577 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC(C)CC1=C(C(=O)c2ccccc2C1=O)O |
| InChi: | InChI=1S/C14H14O3/c1-8(2)7-11-12(15)9-5-3-4-6-10(9)13(16)14(11)17/h3-6,8,17H,7H2,1-2H3 |
| InChiKey: | InChIKey=UASBUFXONXNWEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.