* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | ZINC TARTRATE |
CAS: | 551-64-4 ;22570-08-7 |
EnglishSynonyms: | ZINC TARTRATE |
pro_mdlNumber: | MFCD00054443 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | C1(C(C(=O)O[Zn]OC1=O)O)O |
InChi: | InChI=1S/C4H6O6.Zn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
InChiKey: | InChIKey=VRGNUPCISFMPEM-UHFFFAOYSA-L |
property |
|
Comments: | ASSAY METHOD: T |
Specification: | EXTRA PURE |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.