* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ZINC TARTRATE |
| CAS: | 22570-08-7 ;551-64-4 |
| EnglishSynonyms: | ZINC TARTRATE |
| pro_mdlNumber: | MFCD00054443 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | C1(C(C(=O)O[Zn]OC1=O)O)O |
| InChi: | InChI=1S/C4H6O6.Zn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChiKey: | InChIKey=VRGNUPCISFMPEM-UHFFFAOYSA-L |
|
|
| Comments: | ASSAY METHOD: T |
| Specification: | EXTRA PURE |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.