7-HEPTADECANONE

pro_cas
6064-42-2
pro_cdbregno
CCD00020721
pro_formula
C17 H34 O
pro_molWeight
254.455

basic_info

Product_Name: 7-HEPTADECANONE
CAS: 6064-42-2
EnglishSynonyms: 7-HEPTADECANONE
pro_mdlNumber: MFCD00026546
pro_acceptors: 1
pro_donors: 0
pro_smile: CCCCCCCCCCC(=O)CCCCCC
InChi: InChI=1S/C17H34O/c1-3-5-7-9-10-11-12-14-16-17(18)15-13-8-6-4-2/h3-16H2,1-2H3
InChiKey: InChIKey=NFRKSAMCQGIGRC-UHFFFAOYSA-N