4-OXODECANOIC ACID

pro_cas
pro_cdbregno
CCD00066417
pro_formula
C10 H18 O3
pro_molWeight
186.249

basic_info

Product_Name: 4-OXODECANOIC ACID
EnglishSynonyms: 4-OXODECANOIC ACID
pro_mdlNumber: MFCD00138075
pro_acceptors: 3
pro_donors: 1
pro_smile: CCCCCCC(=O)CCC(=O)O
InChi: InChI=1S/C10H18O3/c1-2-3-4-5-6-9(11)7-8-10(12)13/h2-8H2,1H3,(H,12,13)
InChiKey: InChIKey=SPUWOYCLMKSXKU-UHFFFAOYSA-N