METHYL 6-CHLORO-2H-CHROMENE-3-CARBOXYLATE

pro_cas
68281-65-2
pro_cdbregno
CCD00093666
pro_formula
C11 H9 Cl O3
pro_molWeight
224.642

basic_info

Product_Name: METHYL 6-CHLORO-2H-CHROMENE-3-CARBOXYLATE
CAS: 68281-65-2
EnglishSynonyms: METHYL 6-CHLORO-2H-CHROMENE-3-CARBOXYLATE ; 6-CHLORO-2H-CHROMENE-3-CARBOXYLIC ACID METHYL ESTER
pro_mdlNumber: MFCD00202038
pro_acceptors: 3
pro_donors: 0
pro_smile: COC(=O)C1=Cc2cc(ccc2OC1)Cl
InChi: InChI=1S/C11H9ClO3/c1-14-11(13)8-4-7-5-9(12)2-3-10(7)15-6-8/h2-5H,6H2,1H3
InChiKey: InChIKey=OLQOSWHSVZKSLW-UHFFFAOYSA-N

property

MeltingPoint: 113-115 DEG
Comments: WARNINGS: IRRITANT

secure_info