VITAS-BB TBB015160

pro_cas
pro_cdbregno
CCD00135229
pro_formula
C5H10O4
pro_molWeight
134.13

basic_info

Product_Name: VITAS-BB TBB015160
EnglishSynonyms: VITAS-BB TBB015160
pro_mdlNumber: MFCD00465074
pro_acceptors: 4
pro_donors: 3
pro_smile: OC1CC(O)C(O)CO1
InChi: InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2
InChiKey: InChIKey=ZVQAVWAHRUNNPG-UHFFFAOYSA-N