VITAS-BB TBB019350

pro_cas
pro_cdbregno
CCD00136944
pro_formula
C15H13N3O4
pro_molWeight
299.285

basic_info

Product_Name: VITAS-BB TBB019350
EnglishSynonyms: VITAS-BB TBB019350
pro_mdlNumber: MFCD00477715
pro_acceptors: 7
pro_donors: 1
pro_smile: COC1=CC=CC=C1C(=O)N\N=C\C1=C(C=CC=C1)[N+]([O-])=O
InChi: InChI=1S/C15H13N3O4/c1-22-14-9-5-3-7-12(14)15(19)17-16-10-11-6-2-4-8-13(11)18(20)21/h2-10H,1H3,(H,17,19)/b16-10+
InChiKey: InChIKey=GVYYJUIAYQCRDB-MHWRWJLKSA-N