4-OXOOCTANOIC ACID

pro_cas
4316-44-3
pro_cdbregno
CCD00139664
pro_formula
C8 H14 O3
pro_molWeight
158.196

basic_info

Product_Name: 4-OXOOCTANOIC ACID
CAS: 4316-44-3
EnglishSynonyms: 4-OXOOCTANOIC ACID
pro_mdlNumber: MFCD00520681
pro_acceptors: 3
pro_donors: 1
pro_smile: CCCCC(=O)CCC(=O)O
InChi: InChI=1S/C8H14O3/c1-2-3-4-7(9)5-6-8(10)11/h2-6H2,1H3,(H,10,11)
InChiKey: InChIKey=RITBMTJPNSJVHF-UHFFFAOYSA-N

property

secure_info