ISONICOTINIC ACID (1-(4-PYRIDYL)ETHYLIDENE)HYDRAZIDE

pro_cas
91803-29-1
pro_cdbregno
CCD00217632
pro_formula
C13 H12 N4 O
pro_molWeight
240.265

basic_info

Product_Name: ISONICOTINIC ACID (1-(4-PYRIDYL)ETHYLIDENE)HYDRAZIDE
CAS: 91803-29-1
EnglishSynonyms: N'-(1-(4-PYRIDINYL)ETHYLIDENE)ISONICOTINOHYDRAZIDE ; ISONICOTINIC ACID (1-(4-PYRIDYL)ETHYLIDENE)HYDRAZIDE
pro_mdlNumber: MFCD01344873
pro_acceptors: 5
pro_donors: 1
pro_smile: C/C(=N\NC(=O)c1ccncc1)/c2ccncc2
InChi: InChI=1S/C13H12N4O/c1-10(11-2-6-14-7-3-11)16-17-13(18)12-4-8-15-9-5-12/h2-9H,1H3,(H,17,18)/b16-10+
InChiKey: InChIKey=KQBTUBFRMPKRFX-MHWRWJLKSA-N

* If the product has intellectual property rights, a license granted is must or contact us.