ISONICOTINIC ACID 2-(2-(PHENETHYLCARBAMOYL)ETHYL)HYDRAZIDE

pro_cas
15563-29-8
pro_cdbregno
CCD00245532
pro_formula
C17 H20 N4 O2
pro_molWeight
312.371

basic_info

Product_Name: ISONICOTINIC ACID 2-(2-(PHENETHYLCARBAMOYL)ETHYL)HYDRAZIDE
CAS: 15563-29-8
EnglishSynonyms: ISONICOTINIC ACID 2-(2-(PHENETHYLCARBAMOYL)ETHYL)HYDRAZIDE
pro_mdlNumber: MFCD01717734
pro_acceptors: 6
pro_donors: 3
pro_smile: c1ccc(cc1)CCNC(=O)CCNNC(=O)c2ccncc2
InChi: InChI=1S/C17H20N4O2/c22-16(19-12-6-14-4-2-1-3-5-14)9-13-20-21-17(23)15-7-10-18-11-8-15/h1-5,7-8,10-11,20H,6,9,12-13H2,(H,19,22)(H,21,23)
InChiKey: InChIKey=QXBMEGUKVLFJAM-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.