ISONICOTINIC ACID 2-UNDECYLHYDRAZIDE

pro_cas
15563-06-1
pro_cdbregno
CCD00245541
pro_formula
C17 H29 N3 O
pro_molWeight
291.436

basic_info

Product_Name: ISONICOTINIC ACID 2-UNDECYLHYDRAZIDE
CAS: 15563-06-1
EnglishSynonyms: ISONICOTINIC ACID 2-UNDECYLHYDRAZIDE
pro_mdlNumber: MFCD01717751
pro_acceptors: 4
pro_donors: 2
pro_smile: CCCCCCCCCCCNNC(=O)c1ccncc1
InChi: InChI=1S/C17H29N3O/c1-2-3-4-5-6-7-8-9-10-13-19-20-17(21)16-11-14-18-15-12-16/h11-12,14-15,19H,2-10,13H2,1H3,(H,20,21)
InChiKey: InChIKey=ASPHVMZAORPPAC-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.