ISONICOTINIC ACID 2-(2-((P-CHLOROBENZYL)CARBAMOYL)ETHYL)HYDRAZIDE

pro_cas
13012-74-3
pro_cdbregno
CCD00245575
pro_formula
C16 H17 Cl N4 O2
pro_molWeight
332.789

basic_info

Product_Name: ISONICOTINIC ACID 2-(2-((P-CHLOROBENZYL)CARBAMOYL)ETHYL)HYDRAZIDE
CAS: 13012-74-3
EnglishSynonyms: ISONICOTINIC ACID 2-(2-((P-CHLOROBENZYL)CARBAMOYL)ETHYL)HYDRAZIDE
pro_mdlNumber: MFCD01717850
pro_acceptors: 6
pro_donors: 3
pro_smile: c1cc(ccc1CNC(=O)CCNNC(=O)c2ccncc2)Cl
InChi: InChI=1S/C16H17ClN4O2/c17-14-3-1-12(2-4-14)11-19-15(22)7-10-20-21-16(23)13-5-8-18-9-6-13/h1-6,8-9,20H,7,10-11H2,(H,19,22)(H,21,23)
InChiKey: InChIKey=JFCLDVTWLBPXFS-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.