ISONICOTINIC ACID 2-(2-(CYCLOHEXYLCARBAMOYL)ETHYL)HYDRAZIDE

pro_cas
15563-10-7
pro_cdbregno
CCD00245577
pro_formula
C15 H22 N4 O2
pro_molWeight
290.365

basic_info

Product_Name: ISONICOTINIC ACID 2-(2-(CYCLOHEXYLCARBAMOYL)ETHYL)HYDRAZIDE
CAS: 15563-10-7
EnglishSynonyms: ISONICOTINIC ACID 2-(2-(CYCLOHEXYLCARBAMOYL)ETHYL)HYDRAZIDE
pro_mdlNumber: MFCD01717855
pro_acceptors: 6
pro_donors: 3
pro_smile: c1cnccc1C(=O)NNCCC(=O)NC2CCCCC2
InChi: InChI=1S/C15H22N4O2/c20-14(18-13-4-2-1-3-5-13)8-11-17-19-15(21)12-6-9-16-10-7-12/h6-7,9-10,13,17H,1-5,8,11H2,(H,18,20)(H,19,21)
InChiKey: InChIKey=SIAZUVWUDWNFIH-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.