7-HYDROXY-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE

pro_cas
67292-75-5
pro_cdbregno
CCD00245631
pro_formula
C20 H19 N O4 . Cl H
pro_molWeight
373.834

basic_info

Product_Name: 7-HYDROXY-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE
CAS: 67292-75-5
EnglishSynonyms: 7-HYDROXY-8-(MORPHOLINOMETHYL)ISOFLAVONE HYDROCHLORIDE
pro_mdlNumber: MFCD01718059
pro_acceptors: 5
pro_donors: 1
pro_smile: c1ccc(cc1)c2coc3c(c2=O)ccc(c3CN4CCOCC4)O.Cl
InChi: InChI=1S/C20H19NO4.ClH/c22-18-7-6-15-19(23)17(14-4-2-1-3-5-14)13-25-20(15)16(18)12-21-8-10-24-11-9-21;/h1-7,13,22H,8-12H2;1H
InChiKey: InChIKey=GRGICIRGYVZQHJ-UHFFFAOYSA-N