7-HYDROXY-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE

pro_cas
67292-76-6
pro_cdbregno
CCD00245632
pro_formula
C21 H21 N O3 . Cl H
pro_molWeight
371.862

basic_info

Product_Name: 7-HYDROXY-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE
CAS: 67292-76-6
EnglishSynonyms: 7-HYDROXY-8-(PIPERIDINOMETHYL)ISOFLAVONE HYDROCHLORIDE
pro_mdlNumber: MFCD01718060
pro_acceptors: 4
pro_donors: 1
pro_smile: c1ccc(cc1)c2coc3c(c2=O)ccc(c3CN4CCCCC4)O.Cl
InChi: InChI=1S/C21H21NO3.ClH/c23-19-10-9-16-20(24)18(15-7-3-1-4-8-15)14-25-21(16)17(19)13-22-11-5-2-6-12-22;/h1,3-4,7-10,14,23H,2,5-6,11-13H2;1H
InChiKey: InChIKey=XNSXHILCMIUBNA-UHFFFAOYSA-N