N-(2-FURYLMETHYL)-6-(1H-PYRAZOL-4-YL)NICOTINAMIDE

pro_cas
pro_cdbregno
CCD00402795
pro_formula
C14 H12 N4 O2
pro_molWeight
268.275

basic_info

Product_Name: N-(2-FURYLMETHYL)-6-(1H-PYRAZOL-4-YL)NICOTINAMIDE
EnglishSynonyms: N-(2-FURYLMETHYL)-6-(1H-PYRAZOL-4-YL)NICOTINAMIDE
pro_mdlNumber: MFCD03647138
pro_acceptors: 6
pro_donors: 2
pro_smile: c1cc(oc1)CNC(=O)c2ccc(nc2)c3c[nH]nc3
InChi: InChI=1S/C14H12N4O2/c19-14(16-9-12-2-1-5-20-12)10-3-4-13(15-6-10)11-7-17-18-8-11/h1-8H,9H2,(H,16,19)(H,17,18)
InChiKey: InChIKey=HPYHNTCRGKGUKR-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.