N-(2-FURYLMETHYL)-6-[1-(4-METHOXYPHENYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE

pro_cas
pro_cdbregno
CCD00402837
pro_formula
C21 H18 N4 O3
pro_molWeight
374.398

basic_info

Product_Name: N-(2-FURYLMETHYL)-6-[1-(4-METHOXYPHENYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE
EnglishSynonyms: N-(2-FURYLMETHYL)-6-[1-(4-METHOXYPHENYL)-1H-PYRAZOL-4-YL]NICOTINAMIDE
pro_mdlNumber: MFCD03647182
pro_acceptors: 7
pro_donors: 1
pro_smile: COc1ccc(cc1)n2cc(cn2)c3ccc(cn3)C(=O)NCc4ccco4
InChi: InChI=1S/C21H18N4O3/c1-27-18-7-5-17(6-8-18)25-14-16(12-24-25)20-9-4-15(11-22-20)21(26)23-13-19-3-2-10-28-19/h2-12,14H,13H2,1H3,(H,23,26)
InChiKey: InChIKey=URGQTFKZXKXSSQ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.