N-(1,1-DIOXIDOTETRAHYDRO-3-THIENYL)-2-[(4-ISOPROPOXYBENZOYL)AMINO]-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHENE-3-CARBOXAMIDE

pro_cas
618078-85-6
pro_cdbregno
CCD00404844
pro_formula
C23 H28 N2 O5 S2
pro_molWeight
476.615

basic_info

Product_Name: N-(1,1-DIOXIDOTETRAHYDRO-3-THIENYL)-2-[(4-ISOPROPOXYBENZOYL)AMINO]-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHENE-3-CARBOXAMIDE
CAS: 618078-85-6
EnglishSynonyms: N-(1,1-DIOXIDOTETRAHYDRO-3-THIENYL)-2-[(4-ISOPROPOXYBENZOYL)AMINO]-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHENE-3-CARBOXAMIDE
pro_mdlNumber: MFCD03662826
pro_acceptors: 7
pro_donors: 2
pro_smile: CC(C)Oc1ccc(cc1)C(=O)Nc2c(c3c(s2)CCCC3)C(=O)NC4CCS(=O)(=O)C4
InChi: InChI=1S/C23H28N2O5S2/c1-14(2)30-17-9-7-15(8-10-17)21(26)25-23-20(18-5-3-4-6-19(18)31-23)22(27)24-16-11-12-32(28,29)13-16/h7-10,14,16H,3-6,11-13H2,1-2H3,(H,24,27)(H,25,26)
InChiKey: InChIKey=OIYWUDNOEBNCOP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.