DIETHYL 2,4-PYRROLIDINEDICARBOXYLATE

pro_cas
79265-57-9
pro_cdbregno
CCD00451324
pro_formula
C10 H17 N O4
pro_molWeight
215.247

basic_info

Product_Name: DIETHYL 2,4-PYRROLIDINEDICARBOXYLATE
CAS: 79265-57-9
EnglishSynonyms: DIETHYL 2,4-PYRROLIDINEDICARBOXYLATE
pro_mdlNumber: MFCD04116253
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1CC(NC1)C(=O)OCC
InChi: InChI=1S/C10H17NO4/c1-3-14-9(12)7-5-8(11-6-7)10(13)15-4-2/h7-8,11H,3-6H2,1-2H3
InChiKey: InChIKey=WJKNQWKTAMSRJU-UHFFFAOYSA-N

property

secure_info