DIMETHYL 3-[(5-CHLORO-2-METHYLANILINO)CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454218
pro_formula
C24 H19 Cl N2 O5
pro_molWeight
450.876

basic_info

Product_Name: DIMETHYL 3-[(5-CHLORO-2-METHYLANILINO)CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 3-[(5-CHLORO-2-METHYLANILINO)CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE
pro_mdlNumber: MFCD04119880
pro_acceptors: 7
pro_donors: 1
pro_smile: Cc1ccc(cc1NC(=O)c2c(c(c3n2ccc4c3cccc4)C(=O)OC)C(=O)OC)Cl
InChi: InChI=1S/C24H19ClN2O5/c1-13-8-9-15(25)12-17(13)26-22(28)21-19(24(30)32-3)18(23(29)31-2)20-16-7-5-4-6-14(16)10-11-27(20)21/h4-12H,1-3H3,(H,26,28)
InChiKey: InChIKey=XLPXNLGOMMSBGV-UHFFFAOYSA-N