DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454227
pro_formula
C25 H21 N O7
pro_molWeight
447.441

basic_info

Product_Name: DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 1-(3,4-DIMETHOXYBENZOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
pro_mdlNumber: MFCD04119889
pro_acceptors: 8
pro_donors: 0
pro_smile: COc1ccc(cc1OC)C(=O)c2c(c(c3n2c4ccccc4cc3)C(=O)OC)C(=O)OC
InChi: InChI=1S/C25H21NO7/c1-30-18-12-10-15(13-19(18)31-2)23(27)22-21(25(29)33-4)20(24(28)32-3)17-11-9-14-7-5-6-8-16(14)26(17)22/h5-13H,1-4H3
InChiKey: InChIKey=QWJMUNDMTPBZKX-UHFFFAOYSA-N