DIMETHYL 1-(2-NAPHTHOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454228
pro_formula
C27 H19 N O5
pro_molWeight
437.449

basic_info

Product_Name: DIMETHYL 1-(2-NAPHTHOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 1-(2-NAPHTHOYL)PYRROLO(1,2-A)QUINOLINE-2,3-DICARBOXYLATE
pro_mdlNumber: MFCD04119890
pro_acceptors: 6
pro_donors: 0
pro_smile: COC(=O)c1c2ccc3ccccc3n2c(c1C(=O)OC)C(=O)c4ccc5ccccc5c4
InChi: InChI=1S/C27H19NO5/c1-32-26(30)22-21-14-13-17-8-5-6-10-20(17)28(21)24(23(22)27(31)33-2)25(29)19-12-11-16-7-3-4-9-18(16)15-19/h3-15H,1-2H3
InChiKey: InChIKey=SKWRJJPWPFGACJ-UHFFFAOYSA-N