DIMETHYL 3-[[3-(TRIFLUOROMETHYL)ANILINO]CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE

pro_cas
pro_cdbregno
CCD00454306
pro_formula
C24 H17 F3 N2 O5
pro_molWeight
470.401

basic_info

Product_Name: DIMETHYL 3-[[3-(TRIFLUOROMETHYL)ANILINO]CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE
EnglishSynonyms: DIMETHYL 3-[[3-(TRIFLUOROMETHYL)ANILINO]CARBONYL]PYRROLO[2,1-A]ISOQUINOLINE-1,2-DICARBOXYLATE
pro_mdlNumber: MFCD04119968
pro_acceptors: 7
pro_donors: 1
pro_smile: COC(=O)c1c(c(n2c1c3ccccc3cc2)C(=O)Nc4cccc(c4)C(F)(F)F)C(=O)OC
InChi: InChI=1S/C24H17F3N2O5/c1-33-22(31)17-18(23(32)34-2)20(29-11-10-13-6-3-4-9-16(13)19(17)29)21(30)28-15-8-5-7-14(12-15)24(25,26)27/h3-12H,1-2H3,(H,28,30)
InChiKey: InChIKey=SKXVPKDXYXPVNM-UHFFFAOYSA-N