(4-FLUOROPHENYL)(PIPERAZIN-1-YL)ACETIC ACID

pro_cas
853681-12-6
pro_cdbregno
CCD00548713
pro_formula
C12 H15 F N2 O2
pro_molWeight
238.26

basic_info

Product_Name: (4-FLUOROPHENYL)(PIPERAZIN-1-YL)ACETIC ACID
CAS: 853681-12-6
EnglishSynonyms: (4-FLUOROPHENYL)(PIPERAZIN-1-YL)ACETIC ACID ; 2-(4-FLUOROPHENYL)-2-(PIPERAZIN-1-YL)ACETIC ACID
pro_mdlNumber: MFCD06654836
pro_acceptors: 4
pro_donors: 2
pro_smile: c1cc(ccc1C(C(=O)O)N2CCNCC2)F
InChi: InChI=1S/C12H15FN2O2/c13-10-3-1-9(2-4-10)11(12(16)17)15-7-5-14-6-8-15/h1-4,11,14H,5-8H2,(H,16,17)
InChiKey: InChIKey=HRYYYIYCBGQARF-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.