1,3-DIMETHOXY-5-IODOBENZENE

pro_cas
25245-27-6
pro_cdbregno
CCD00694133
pro_formula
C8 H9 I O2
pro_molWeight
264.057

basic_info

Product_Name: 1,3-DIMETHOXY-5-IODOBENZENE
CAS: 25245-27-6
EnglishSynonyms: 3,5-DIMETHOXY-1-IODOBENZENE ; 1-IODO-3,5-DIMETHOXYBENZENE ; 1,3-DIMETHOXY-5-IODOBENZENE ; 5-IODO-1,3-DIMETHOXYBENZENE
pro_mdlNumber: MFCD08729270
pro_acceptors: 2
pro_donors: 0
pro_smile: COc1cc(cc(c1)I)OC
InChi: InChI=1S/C8H9IO2/c1-10-7-3-6(9)4-8(5-7)11-2/h3-5H,1-2H3
InChiKey: InChIKey=MMOMUEFLZAHIAZ-UHFFFAOYSA-N