2,4-DIBROMO-1-IODOBENZENE

pro_cas
19393-94-3
pro_cdbregno
CCD00784159
pro_formula
C6 H3 Br2 I
pro_molWeight
361.798

basic_info

Product_Name: 2,4-DIBROMO-1-IODOBENZENE
CAS: 19393-94-3
EnglishSynonyms: 2,4-DIBROMOIODOBENZENE ; 2,4-DIBROMO-1-IODOBENZENE ; 1,3-DIBROMO-4-IODOBENZENE
pro_mdlNumber: MFCD09753709
pro_acceptors: 0
pro_donors: 0
pro_smile: c1cc(c(cc1Br)Br)I
InChi: InChI=1S/C6H3Br2I/c7-4-1-2-6(9)5(8)3-4/h1-3H
InChiKey: InChIKey=GVWUUPHBAZERQS-UHFFFAOYSA-N

property

secure_info