RARECHEM AL MS 0474

pro_cas
pro_cdbregno
CCD00875308
pro_formula
C9 H8 Cl N O4
pro_molWeight
229.618

basic_info

Product_Name: RARECHEM AL MS 0474
EnglishSynonyms: RARECHEM AL MS 0474
pro_mdlNumber: MFCD09925071
pro_acceptors: 5
pro_donors: 2
pro_smile: c1c(cnc(c1CC(=O)O)Cl)CC(=O)O
InChi: InChI=1S/C9H8ClNO4/c10-9-6(3-8(14)15)1-5(4-11-9)2-7(12)13/h1,4H,2-3H2,(H,12,13)(H,14,15)
InChiKey: InChIKey=QCQJDEIILPLASE-UHFFFAOYSA-N