RARECHEM AL MX 0474

pro_cas
pro_cdbregno
CCD00875950
pro_formula
C9 H5 Cl3 O3
pro_molWeight
267.495

basic_info

Product_Name: RARECHEM AL MX 0474
EnglishSynonyms: RARECHEM AL MX 0474
pro_mdlNumber: MFCD09925713
pro_acceptors: 3
pro_donors: 1
pro_smile: c1c(cc(c(c1Cl)C(=O)CC(=O)O)Cl)Cl
InChi: InChI=1S/C9H5Cl3O3/c10-4-1-5(11)9(6(12)2-4)7(13)3-8(14)15/h1-2H,3H2,(H,14,15)
InChiKey: InChIKey=OBXRCLMNIFYWSG-UHFFFAOYSA-N