RARECHEM AL RA 0474

pro_cas
pro_cdbregno
CCD00877229
pro_formula
C14 H22 O4
pro_molWeight
254.324

basic_info

Product_Name: RARECHEM AL RA 0474
EnglishSynonyms: RARECHEM AL RA 0474
pro_mdlNumber: MFCD09926992
pro_acceptors: 4
pro_donors: 2
pro_smile: COc1cc(c(cc1CCCO)OC)CCCO
InChi: InChI=1S/C14H22O4/c1-17-13-9-12(6-4-8-16)14(18-2)10-11(13)5-3-7-15/h9-10,15-16H,3-8H2,1-2H3
InChiKey: InChIKey=UQVKFRHLSARMQB-UHFFFAOYSA-N