8-BROMO-4-CHLORO-6-METHYLQUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER

pro_cas
1016828-40-2
pro_cdbregno
CCD00892265
pro_formula
C13 H11 Br Cl N O2
pro_molWeight
328.592

basic_info

Product_Name: 8-BROMO-4-CHLORO-6-METHYLQUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS: 1016828-40-2
EnglishSynonyms: 8-BROMO-4-CHLORO-6-METHYLQUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER ; ETHYL 8-BROMO-4-CHLORO-6-METHYLQUINOLINE-3-CARBOXYLATE
pro_mdlNumber: MFCD09946074
pro_acceptors: 3
pro_donors: 0
pro_smile: CCOC(=O)c1cnc2c(c1Cl)cc(cc2Br)C
InChi: InChI=1S/C13H11BrClNO2/c1-3-18-13(17)9-6-16-12-8(11(9)15)4-7(2)5-10(12)14/h4-6H,3H2,1-2H3
InChiKey: InChIKey=GCVTVSDMJWECPZ-UHFFFAOYSA-N