(2-ISOPROPYL-THIAZOL-5-YL)-METHYLAMINE

pro_cas
933734-30-6
pro_cdbregno
CCD00915892
pro_formula
C7 H12 N2 S
pro_molWeight
156.252

basic_info

Product_Name: (2-ISOPROPYL-THIAZOL-5-YL)-METHYLAMINE
CAS: 933734-30-6
EnglishSynonyms: [2-(PROPAN-2-YL)-1,3-THIAZOL-5-YL]METHANAMINE ; (2-ISOPROPYL-THIAZOL-5-YL)-METHYLAMINE
pro_mdlNumber: MFCD10007023
pro_acceptors: 2
pro_donors: 1
pro_smile: CC(C)c1ncc(s1)CN
InChi: InChI=1S/C7H12N2S/c1-5(2)7-9-4-6(3-8)10-7/h4-5H,3,8H2,1-2H3
InChiKey: InChIKey=BSJKAPQBFCVVSW-UHFFFAOYSA-N