5-ETHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE

pro_cas
pro_cdbregno
CCD01084358
pro_formula
C12 H16 O4
pro_molWeight
224.254

basic_info

Product_Name: 5-ETHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
EnglishSynonyms: 5-ETHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
pro_mdlNumber: MFCD11178705
pro_acceptors: 4
pro_donors: 0
pro_smile: CCOCCC(=O)CC(=O)c1ccc(o1)C
InChi: InChI=1S/C12H16O4/c1-3-15-7-6-10(13)8-11(14)12-5-4-9(2)16-12/h4-5H,3,6-8H2,1-2H3
InChiKey: InChIKey=MQFNMDYTWDLUMQ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.