5-METHOXY-2-[(1-METHYL-1H-PYRAZOL-4-YL)METHOXY]BENZALDEHYDE

pro_cas
pro_cdbregno
CCD01153128
pro_formula
C13 H14 N2 O3
pro_molWeight
246.265

basic_info

Product_Name: 5-METHOXY-2-[(1-METHYL-1H-PYRAZOL-4-YL)METHOXY]BENZALDEHYDE
EnglishSynonyms: 5-METHOXY-2-[(1-METHYL-1H-PYRAZOL-4-YL)METHOXY]BENZALDEHYDE
pro_mdlNumber: MFCD11524765
pro_acceptors: 5
pro_donors: 0
pro_smile: Cn1cc(cn1)COc2ccc(cc2C=O)OC
InChi: InChI=1S/C13H14N2O3/c1-15-7-10(6-14-15)9-18-13-4-3-12(17-2)5-11(13)8-16/h3-8H,9H2,1-2H3
InChiKey: InChIKey=SEBAMTYRHHMFLB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.