DIETHYL((2-[(5-METHYL-1,3-BENZOTHIAZOL-2-YL)AMINO]ETHYL))AMINE

pro_cas
pro_cdbregno
CCD01163215
pro_formula
C14 H21 N3 S
pro_molWeight
263.407

basic_info

Product_Name: DIETHYL((2-[(5-METHYL-1,3-BENZOTHIAZOL-2-YL)AMINO]ETHYL))AMINE
EnglishSynonyms: DIETHYL((2-[(5-METHYL-1,3-BENZOTHIAZOL-2-YL)AMINO]ETHYL))AMINE
pro_mdlNumber: MFCD11535261
pro_acceptors: 3
pro_donors: 1
pro_smile: CCN(CC)CCNc1nc2cc(ccc2s1)C
InChi: InChI=1S/C14H21N3S/c1-4-17(5-2)9-8-15-14-16-12-10-11(3)6-7-13(12)18-14/h6-7,10H,4-5,8-9H2,1-3H3,(H,15,16)
InChiKey: InChIKey=GTEPGWKERZVTPG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.