8-[(3-AMINOPENTAN-2-YL)OXY]-2-METHYLQUINOLINE

pro_cas
pro_cdbregno
CCD01176912
pro_formula
C15 H20 N2 O
pro_molWeight
244.336

basic_info

Product_Name: 8-[(3-AMINOPENTAN-2-YL)OXY]-2-METHYLQUINOLINE
EnglishSynonyms: 8-[(3-AMINOPENTAN-2-YL)OXY]-2-METHYLQUINOLINE
pro_mdlNumber: MFCD11549262
pro_acceptors: 3
pro_donors: 1
pro_smile: CCC(C(C)Oc1cccc2c1nc(cc2)C)N
InChi: InChI=1S/C15H20N2O/c1-4-13(16)11(3)18-14-7-5-6-12-9-8-10(2)17-15(12)14/h5-9,11,13H,4,16H2,1-3H3
InChiKey: InChIKey=CPOLHVPHJDWETP-UHFFFAOYSA-N