BUTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE

pro_cas
pro_cdbregno
CCD01232310
pro_formula
C13 H17 N O2
pro_molWeight
219.282

basic_info

Product_Name: BUTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
EnglishSynonyms: BUTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
pro_mdlNumber: MFCD11618701
pro_acceptors: 3
pro_donors: 1
pro_smile: CCCCOC(=O)c1ccc2c(c1)CCN2
InChi: InChI=1S/C13H17NO2/c1-2-3-8-16-13(15)11-4-5-12-10(9-11)6-7-14-12/h4-5,9,14H,2-3,6-8H2,1H3
InChiKey: InChIKey=SJENYEANDJXZSX-UHFFFAOYSA-N