HONGHUI-MED 400020000000

pro_cas
pro_cdbregno
CCD01292555
pro_formula
C26 H28 O3 S
pro_molWeight
420.57

basic_info

Product_Name: HONGHUI-MED 400020000000
EnglishSynonyms: HONGHUI-MED 400020000000
pro_mdlNumber: MFCD11870838
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc(cc1)COC[C@H]2[C@@H]([C@H](CS2)OCc3ccccc3)OCc4ccccc4
InChi: InChI=1S/C26H28O3S/c1-4-10-21(11-5-1)16-27-19-25-26(29-18-23-14-8-3-9-15-23)24(20-30-25)28-17-22-12-6-2-7-13-22/h1-15,24-26H,16-20H2/t24-,25-,26+/m0/s1
InChiKey: InChIKey=IISDOLHHPNAZII-KKUQBAQOSA-N

* If the product has intellectual property rights, a license granted is must or contact us.