HDH-PHARMA 20654

pro_cas
pro_cdbregno
CCD01293113
pro_formula
C18H12ClF3N4O3
pro_molWeight
424.765

basic_info

Product_Name: HDH-PHARMA 20654
EnglishSynonyms: HDH-PHARMA 20654
pro_mdlNumber: MFCD11871402
pro_acceptors: 7
pro_donors: 1
pro_smile: CC1=C(C=CC=C1NC1=NC(Cl)=NC(=C1)C1=CC=CC(OC(F)(F)F)=C1)[N+]([O-])=O
InChi: InChI=1S/C18H12ClF3N4O3/c1-10-13(6-3-7-15(10)26(27)28)23-16-9-14(24-17(19)25-16)11-4-2-5-12(8-11)29-18(20,21)22/h2-9H,1H3,(H,23,24,25)
InChiKey: InChIKey=XJWAOGDQPGFMRK-UHFFFAOYSA-N