HDH-PHARMA 21161

pro_cas
pro_cdbregno
CCD01293741
pro_formula
C20 H20 Cl N3
pro_molWeight
337.852

basic_info

Product_Name: HDH-PHARMA 21161
EnglishSynonyms: HDH-PHARMA 21161
pro_mdlNumber: MFCD11872030
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1cc(ccc1C(C)C)Nc2cc(nc(n2)Cl)c3ccccc3
InChi: InChI=1S/C20H20ClN3/c1-13(2)17-10-9-16(11-14(17)3)22-19-12-18(23-20(21)24-19)15-7-5-4-6-8-15/h4-13H,1-3H3,(H,22,23,24)
InChiKey: InChIKey=SMSUPAHITDAUNC-UHFFFAOYSA-N