HDH-PHARMA 21298

pro_cas
pro_cdbregno
CCD01293743
pro_formula
C21H19ClF3N3O
pro_molWeight
421.848

basic_info

Product_Name: HDH-PHARMA 21298
EnglishSynonyms: HDH-PHARMA 21298
pro_mdlNumber: MFCD11872032
pro_acceptors: 4
pro_donors: 1
pro_smile: CC(C)C1=CC=C(NC2=NC(Cl)=NC(=C2)C2=CC=CC(OC(F)(F)F)=C2)C=C1C
InChi: InChI=1S/C21H19ClF3N3O/c1-12(2)17-8-7-15(9-13(17)3)26-19-11-18(27-20(22)28-19)14-5-4-6-16(10-14)29-21(23,24)25/h4-12H,1-3H3,(H,26,27,28)
InChiKey: InChIKey=ZFNBYSLVOGAHIT-UHFFFAOYSA-N